C10H14N2O2 — CID 154680530
2,2-dimethyl-3,4,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one (PubChem CID 154680530) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2,2-dimethyl-3,4,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one.
| Compound Name | 2,2-dimethyl-3,4,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one |
|---|---|
| PubChem CID | 154680530 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2,2-dimethyl-3,4,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one |
| SMILES | CC1(C)CNCc2[nH]c(=O)ccc2O1 |
| InChI | InChI=1S/C10H14N2O2/c1-10(2)6-11-5-7-8(14-10)3-4-9(13)12-7/h3-4,11H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | NJMPRHSXADRJGW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |