C10H13NO2 — CID 165117481
7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one (PubChem CID 165117481) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one.
| Compound Name | 7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 165117481 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one |
| SMILES | CC1(C)Cc2[nH]c(=O)ccc2CO1 |
| InChI | InChI=1S/C10H13NO2/c1-10(2)5-8-7(6-13-10)3-4-9(12)11-8/h3-4H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | NMSYWGKBGFPLHH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |