C12H16O2 — CID 57120013
6-methoxy-3,3-dimethyl-1,4-dihydroisochromene (PubChem CID 57120013) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 6-methoxy-3,3-dimethyl-1,4-dihydroisochromene.
| Compound Name | 6-methoxy-3,3-dimethyl-1,4-dihydroisochromene |
|---|---|
| PubChem CID | 57120013 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 6-methoxy-3,3-dimethyl-1,4-dihydroisochromene |
| SMILES | COc1ccc2c(c1)CC(C)(C)OC2 |
| InChI | InChI=1S/C12H16O2/c1-12(2)7-10-6-11(13-3)5-4-9(10)8-14-12/h4-6H,7-8H2,1-3H3 |
| InChIKey | QOYZJYOQXWAFRO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |