C20H22N4O2S — CID 1387019
5-[(4-methoxyphenyl)methylsulfanyl]-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine (PubChem CID 1387019) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methylsulfanyl]-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine.
| Compound Name | 5-[(4-methoxyphenyl)methylsulfanyl]-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 1387019 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-[(4-methoxyphenyl)methylsulfanyl]-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine |
| SMILES | COc1ccc(CSc2nc(N)c3cc4c(nc3n2)CC(C)(C)OC4)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-20(2)9-16-13(10-26-20)8-15-17(21)23-19(24-18(15)22-16)27-11-12-4-6-14(25-3)7-5-12/h4-8H,9-11H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | BCJOVODFMGJOQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |