C12H13ClO — CID 121007981
6-chloro-2-ethenyl-2-methyl-3,4-dihydrochromene (PubChem CID 121007981) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 6-chloro-2-ethenyl-2-methyl-3,4-dihydrochromene.
| Compound Name | 6-chloro-2-ethenyl-2-methyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 121007981 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 6-chloro-2-ethenyl-2-methyl-3,4-dihydrochromene |
| SMILES | C=CC1(C)CCc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C12H13ClO/c1-3-12(2)7-6-9-8-10(13)4-5-11(9)14-12/h3-5,8H,1,6-7H2,2H3 |
| InChIKey | TZCMUEMGOUDUNJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|