C15H20O — CID 102455266
(2S)-2-ethenyl-2-methyl-6-propan-2-yl-3,4-dihydrochromene (PubChem CID 102455266) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (2S)-2-ethenyl-2-methyl-6-propan-2-yl-3,4-dihydrochromene.
| Compound Name | (2S)-2-ethenyl-2-methyl-6-propan-2-yl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 102455266 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2S)-2-ethenyl-2-methyl-6-propan-2-yl-3,4-dihydrochromene |
| SMILES | C=C[C@]1(C)CCc2cc(C(C)C)ccc2O1 |
| InChI | InChI=1S/C15H20O/c1-5-15(4)9-8-13-10-12(11(2)3)6-7-14(13)16-15/h5-7,10-11H,1,8-9H2,2-4H3/t15-/m1/s1 |
| InChIKey | IWYGSUPTWJGHRU-OAHLLOKOSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|