C13H19FO2 — CID 145165904
ethane;2-fluoro-2-methyl-5-propan-2-yl-1,3-benzodioxole (PubChem CID 145165904) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is ethane;2-fluoro-2-methyl-5-propan-2-yl-1,3-benzodioxole.
| Compound Name | ethane;2-fluoro-2-methyl-5-propan-2-yl-1,3-benzodioxole |
|---|---|
| PubChem CID | 145165904 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | ethane;2-fluoro-2-methyl-5-propan-2-yl-1,3-benzodioxole |
| SMILES | CC.CC(C)c1ccc2c(c1)OC(C)(F)O2 |
| InChI | InChI=1S/C11H13FO2.C2H6/c1-7(2)8-4-5-9-10(6-8)14-11(3,12)13-9;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | YNFFSBDLHRXZMC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |