C11H14O2 — CID 88993276
2,2,3,3-tetradeuterio-6-propan-2-yl-1,4-benzodioxine (PubChem CID 88993276) has the molecular formula C11H14O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2,2,3,3-tetradeuterio-6-propan-2-yl-1,4-benzodioxine.
| Compound Name | 2,2,3,3-tetradeuterio-6-propan-2-yl-1,4-benzodioxine |
|---|---|
| PubChem CID | 88993276 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2,2,3,3-tetradeuterio-6-propan-2-yl-1,4-benzodioxine |
| SMILES | [2H]C1([2H])Oc2ccc(C(C)C)cc2OC1([2H])[2H] |
| InChI | InChI=1S/C11H14O2/c1-8(2)9-3-4-10-11(7-9)13-6-5-12-10/h3-4,7-8H,5-6H2,1-2H3/i5D2,6D2 |
| InChIKey | KPRFGIWZMADDIL-NZLXMSDQSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |