C10H14NO2+ — CID 7047685
[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]azanium (PubChem CID 7047685) has the molecular formula C10H14NO2+ and a molecular weight of 180.23 g/mol. Its IUPAC name is [(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]azanium.
| Compound Name | [(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7047685 |
| Molecular Formula | C10H14NO2+ |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | [(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH3+])c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H13NO2/c1-7(11)8-2-3-9-10(6-8)13-5-4-12-9/h2-3,6-7H,4-5,11H2,1H3/p+1/t7-/m1/s1 |
| InChIKey | ABUSRLBOAUOYSM-SSDOTTSWSA-O |
| XLogP | 0.76 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |