C13H25NO2 — CID 159540292
azane;methane;6-propan-2-yl-2,3-dihydro-1,4-benzodioxine (PubChem CID 159540292) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is azane;methane;6-propan-2-yl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | azane;methane;6-propan-2-yl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 159540292 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | azane;methane;6-propan-2-yl-2,3-dihydro-1,4-benzodioxine |
| SMILES | C.C.CC(C)c1ccc2c(c1)OCCO2.N |
| InChI | InChI=1S/C11H14O2.2CH4.H3N/c1-8(2)9-3-4-10-11(7-9)13-6-5-12-10;;;/h3-4,7-8H,5-6H2,1-2H3;2*1H4;1H3 |
| InChIKey | WONFVQAAOYAHRJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |