C18H20O2 — CID 58689144
7-(4-propan-2-ylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 58689144) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 7-(4-propan-2-ylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(4-propan-2-ylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 58689144 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 7-(4-propan-2-ylphenyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CC(C)c1ccc(-c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C18H20O2/c1-13(2)14-4-6-15(7-5-14)16-8-9-17-18(12-16)20-11-3-10-19-17/h4-9,12-13H,3,10-11H2,1-2H3 |
| InChIKey | VQGGFHRHTBPGPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |