C12H14F2O2 — CID 134360540
2,2-difluoro-5-pentan-2-yl-1,3-benzodioxole (PubChem CID 134360540) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2,2-difluoro-5-pentan-2-yl-1,3-benzodioxole.
| Compound Name | 2,2-difluoro-5-pentan-2-yl-1,3-benzodioxole |
|---|---|
| PubChem CID | 134360540 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2,2-difluoro-5-pentan-2-yl-1,3-benzodioxole |
| SMILES | CCCC(C)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H14F2O2/c1-3-4-8(2)9-5-6-10-11(7-9)16-12(13,14)15-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | AZRGIFVNJFMDAE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |