C11H11ClF2O4 — CID 171894537
4-chloro-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butane-1,2-diol (PubChem CID 171894537) has the molecular formula C11H11ClF2O4 and a molecular weight of 280.65 g/mol. Its IUPAC name is 4-chloro-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171894537 |
| Molecular Formula | C11H11ClF2O4 |
| Molecular Weight | 280.65 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-chloro-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C11H11ClF2O4/c12-4-3-7(15)10(16)6-1-2-8-9(5-6)18-11(13,14)17-8/h1-2,5,7,10,15-16H,3-4H2 |
| InChIKey | TUEIPBCKAAEQAH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|