C15H20F2N2O2 — CID 171167683
1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butyl]piperazine (PubChem CID 171167683) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butyl]piperazine |
|---|---|
| PubChem CID | 171167683 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)butyl]piperazine |
| SMILES | CCC[C@@H](c1ccc2c(c1)OC(F)(F)O2)N1CCNCC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-3-12(19-8-6-18-7-9-19)11-4-5-13-14(10-11)21-15(16,17)20-13/h4-5,10,12,18H,2-3,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | HTJBKVZGQSEBHC-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |