C17H26Cl2F2N2O2 — CID 171308434
1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)hexyl]piperazine;dihydrochloride (PubChem CID 171308434) has the molecular formula C17H26Cl2F2N2O2 and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308434 |
| Molecular Formula | C17H26Cl2F2N2O2 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@H](c1ccc2c(c1)OC(F)(F)O2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H24F2N2O2.2ClH/c1-2-3-4-5-14(21-10-8-20-9-11-21)13-6-7-15-16(12-13)23-17(18,19)22-15;;/h6-7,12,14,20H,2-5,8-11H2,1H3;2*1H/t14-;;/m1../s1 |
| InChIKey | XMWXXTDYLGTFNT-FMOMHUKBSA-N |
| XLogP | 4.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|