C15H19ClF2N2O2 — CID 171173110
1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)but-3-enyl]piperazine;hydrochloride (PubChem CID 171173110) has the molecular formula C15H19ClF2N2O2 and a molecular weight of 332.78 g/mol. Its IUPAC name is 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171173110 |
| Molecular Formula | C15H19ClF2N2O2 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@H](c1ccc2c(c1)OC(F)(F)O2)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H18F2N2O2.ClH/c1-2-3-12(19-8-6-18-7-9-19)11-4-5-13-14(10-11)21-15(16,17)20-13;/h2,4-5,10,12,18H,1,3,6-9H2;1H/t12-;/m1./s1 |
| InChIKey | DSTIMPAIUWVCCT-UTONKHPSSA-N |
| XLogP | 2.95 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|