C11H15BO2 — CID 170670927
2-hydroxy-6-propan-2-yl-3,4-dihydro-1,2-benzoxaborinine (PubChem CID 170670927) has the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. Its IUPAC name is 2-hydroxy-6-propan-2-yl-3,4-dihydro-1,2-benzoxaborinine.
| Compound Name | 2-hydroxy-6-propan-2-yl-3,4-dihydro-1,2-benzoxaborinine |
|---|---|
| PubChem CID | 170670927 |
| Molecular Formula | C11H15BO2 |
| Molecular Weight | 190.05 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-hydroxy-6-propan-2-yl-3,4-dihydro-1,2-benzoxaborinine |
| SMILES | CC(C)c1ccc2c(c1)CCB(O)O2 |
| InChI | InChI=1S/C11H15BO2/c1-8(2)9-3-4-11-10(7-9)5-6-12(13)14-11/h3-4,7-8,13H,5-6H2,1-2H3 |
| InChIKey | WLLHFKVDVMSJEQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.05 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|