C20H26B2O4 — CID 157201026
1-hydroxy-5-propan-2-yl-3H-2,1-benzoxaborole;1-hydroxy-6-propan-2-yl-3H-2,1-benzoxaborole (PubChem CID 157201026) has the molecular formula C20H26B2O4 and a molecular weight of 352.05 g/mol. Its IUPAC name is 1-hydroxy-5-propan-2-yl-3H-2,1-benzoxaborole;1-hydroxy-6-propan-2-yl-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-5-propan-2-yl-3H-2,1-benzoxaborole;1-hydroxy-6-propan-2-yl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 157201026 |
| Molecular Formula | C20H26B2O4 |
| Molecular Weight | 352.05 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-hydroxy-5-propan-2-yl-3H-2,1-benzoxaborole;1-hydroxy-6-propan-2-yl-3H-2,1-benzoxaborole |
| SMILES | CC(C)c1ccc2c(c1)B(O)OC2.CC(C)c1ccc2c(c1)COB2O |
| InChI | InChI=1S/2C10H13BO2/c1-7(2)8-3-4-10-9(5-8)6-13-11(10)12;1-7(2)8-3-4-9-6-13-11(12)10(9)5-8/h2*3-5,7,12H,6H2,1-2H3 |
| InChIKey | AQUJPFNGEMTQRF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.05 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|