C13H16BNO5S — CID 171345515
N-cyclopropylsulfonyl-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propanamide (PubChem CID 171345515) has the molecular formula C13H16BNO5S and a molecular weight of 309.15 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propanamide.
| Compound Name | N-cyclopropylsulfonyl-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propanamide |
|---|---|
| PubChem CID | 171345515 |
| Molecular Formula | C13H16BNO5S |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-cyclopropylsulfonyl-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propanamide |
| SMILES | CC(C(=O)NS(=O)(=O)C1CC1)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C13H16BNO5S/c1-8(13(16)15-21(18,19)11-4-5-11)9-2-3-10-7-20-14(17)12(10)6-9/h2-3,6,8,11,17H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | ZQTAMVSWBOZOPP-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|