C16H16BNO5 — CID 68567912
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethoxybenzamide (PubChem CID 68567912) has the molecular formula C16H16BNO5 and a molecular weight of 313.12 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethoxybenzamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 68567912 |
| Molecular Formula | C16H16BNO5 |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C16H16BNO5/c1-21-13-4-3-5-14(22-2)15(13)16(19)18-11-7-6-10-9-23-17(20)12(10)8-11/h3-8,20H,9H2,1-2H3,(H,18,19) |
| InChIKey | JOFIUDPPOXTJRF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|