C16H16BNO3 — CID 67346877
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-phenylpropanamide (PubChem CID 67346877) has the molecular formula C16H16BNO3 and a molecular weight of 281.12 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-phenylpropanamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 67346877 |
| Molecular Formula | C16H16BNO3 |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C16H16BNO3/c19-16(9-6-12-4-2-1-3-5-12)18-14-8-7-13-11-21-17(20)15(13)10-14/h1-5,7-8,10,20H,6,9,11H2,(H,18,19) |
| InChIKey | OSWNAOMWOABQPJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|