C17H18BNO4 — CID 67358997
N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-methoxybenzamide (PubChem CID 67358997) has the molecular formula C17H18BNO4 and a molecular weight of 311.15 g/mol. Its IUPAC name is N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-methoxybenzamide.
| Compound Name | N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 67358997 |
| Molecular Formula | C17H18BNO4 |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2c(c1)B(O)OC2(C)C |
| InChI | InChI=1S/C17H18BNO4/c1-17(2)13-9-8-11(10-14(13)18(21)23-17)19-16(20)12-6-4-5-7-15(12)22-3/h4-10,21H,1-3H3,(H,19,20) |
| InChIKey | JUSPVDCOEDFWGY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|