C17H15BF3NO4 — CID 67359079
N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-(trifluoromethoxy)benzamide (PubChem CID 67359079) has the molecular formula C17H15BF3NO4 and a molecular weight of 365.12 g/mol. Its IUPAC name is N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-(trifluoromethoxy)benzamide.
| Compound Name | N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 67359079 |
| Molecular Formula | C17H15BF3NO4 |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-2-(trifluoromethoxy)benzamide |
| SMILES | CC1(C)OB(O)c2cc(NC(=O)c3ccccc3OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H15BF3NO4/c1-16(2)12-8-7-10(9-13(12)18(24)26-16)22-15(23)11-5-3-4-6-14(11)25-17(19,20)21/h3-9,24H,1-2H3,(H,22,23) |
| InChIKey | QIQZKJSXFCBZGR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|