C21H21BClN3O3 — CID 90330409
2-chloro-4-(4-ethylpyrazol-1-yl)-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide (PubChem CID 90330409) has the molecular formula C21H21BClN3O3 and a molecular weight of 409.68 g/mol. Its IUPAC name is 2-chloro-4-(4-ethylpyrazol-1-yl)-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide.
| Compound Name | 2-chloro-4-(4-ethylpyrazol-1-yl)-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide |
|---|---|
| PubChem CID | 90330409 |
| Molecular Formula | C21H21BClN3O3 |
| Molecular Weight | 409.68 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-chloro-4-(4-ethylpyrazol-1-yl)-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide |
| SMILES | CCc1cnn(-c2ccc(C(=O)Nc3ccc4c(c3)B(O)OC4(C)C)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H21BClN3O3/c1-4-13-11-24-26(12-13)15-6-7-16(19(23)10-15)20(27)25-14-5-8-17-18(9-14)22(28)29-21(17,2)3/h5-12,28H,4H2,1-3H3,(H,25,27) |
| InChIKey | FWHDGNKBBVJSOK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|