C17H16BClFNO3 — CID 67358094
6-chloro-2-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-3-methylbenzamide (PubChem CID 67358094) has the molecular formula C17H16BClFNO3 and a molecular weight of 347.58 g/mol. Its IUPAC name is 6-chloro-2-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-3-methylbenzamide.
| Compound Name | 6-chloro-2-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 67358094 |
| Molecular Formula | C17H16BClFNO3 |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-chloro-2-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-3-methylbenzamide |
| SMILES | Cc1ccc(Cl)c(C(=O)Nc2ccc3c(c2)B(O)OC3(C)C)c1F |
| InChI | InChI=1S/C17H16BClFNO3/c1-9-4-7-13(19)14(15(9)20)16(22)21-10-5-6-11-12(8-10)18(23)24-17(11,2)3/h4-8,23H,1-3H3,(H,21,22) |
| InChIKey | OXIAWOGKEDPBOC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|