C16H11BF5NO3 — CID 87369863
2,3,4,5,6-pentafluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide (PubChem CID 87369863) has the molecular formula C16H11BF5NO3 and a molecular weight of 371.07 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide |
|---|---|
| PubChem CID | 87369863 |
| Molecular Formula | C16H11BF5NO3 |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide |
| SMILES | CC1(C)OB(O)c2cc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C16H11BF5NO3/c1-16(2)7-4-3-6(5-8(7)17(25)26-16)23-15(24)9-10(18)12(20)14(22)13(21)11(9)19/h3-5,25H,1-2H3,(H,23,24) |
| InChIKey | ANSBGSHLZKKDQI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|