C9H12BNO2 — CID 58373100
1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine (PubChem CID 58373100) has the molecular formula C9H12BNO2 and a molecular weight of 177.01 g/mol. Its IUPAC name is 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine.
| Compound Name | 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine |
|---|---|
| PubChem CID | 58373100 |
| Molecular Formula | C9H12BNO2 |
| Molecular Weight | 177.01 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine |
| SMILES | CC1(C)OB(O)c2cc(N)ccc21 |
| InChI | InChI=1S/C9H12BNO2/c1-9(2)7-4-3-6(11)5-8(7)10(12)13-9/h3-5,12H,11H2,1-2H3 |
| InChIKey | MAOKJYHLICDJNY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.01 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|