About 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine
1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine (PubChem CID 58373100) has the molecular formula C9H12BNO2
and a molecular weight of 177.01 g/mol. Its IUPAC name is 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine.
Molecular Properties
| Compound Name | 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine |
| PubChem CID | 58373100 |
| Molecular Formula | C9H12BNO2 |
| Molecular Weight | 177.01 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine |
| SMILES | CC1(C)OB(O)c2cc(N)ccc21 |
| InChI | InChI=1S/C9H12BNO2/c1-9(2)7-4-3-6(11)5-8(7)10(12)13-9/h3-5,12H,11H2,1-2H3 |
| InChIKey | MAOKJYHLICDJNY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.01 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine?
The IUPAC name of 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine (CID 58373100) is 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine.
What is the SMILES notation for 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine?
The canonical SMILES for 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine is CC1(C)OB(O)c2cc(N)ccc21.
What is the InChIKey of 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine?
The InChIKey is MAOKJYHLICDJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BNO2/c1-9(2)7-4-3-6(11)5-8(7)10(12)13-9/h3-5,12H,11H2,1-2H3.
What are the key properties of 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine?
1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine has a molecular weight of 177.01 g/mol, XLogP of 0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-amine is sourced from PubChem (CID 58373100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).