C16H14BClFNO3 — CID 67359042
2-chloro-6-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide (PubChem CID 67359042) has the molecular formula C16H14BClFNO3 and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide |
|---|---|
| PubChem CID | 67359042 |
| Molecular Formula | C16H14BClFNO3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-chloro-6-fluoro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)benzamide |
| SMILES | CC1(C)OB(O)c2cc(NC(=O)c3c(F)cccc3Cl)ccc21 |
| InChI | InChI=1S/C16H14BClFNO3/c1-16(2)10-7-6-9(8-11(10)17(22)23-16)20-15(21)14-12(18)4-3-5-13(14)19/h3-8,22H,1-2H3,(H,20,21) |
| InChIKey | ITUIVJUSTKTYOL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|