C17H15ClF2N2O2 — CID 131944998
N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2,3-difluoro-4-methylbenzamide (PubChem CID 131944998) has the molecular formula C17H15ClF2N2O2 and a molecular weight of 352.77 g/mol. Its IUPAC name is N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2,3-difluoro-4-methylbenzamide.
| Compound Name | N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2,3-difluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 131944998 |
| Molecular Formula | C17H15ClF2N2O2 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2,3-difluoro-4-methylbenzamide |
| SMILES | CCNC(=O)c1cc(NC(=O)c2ccc(C)c(F)c2F)ccc1Cl |
| InChI | InChI=1S/C17H15ClF2N2O2/c1-3-21-16(23)12-8-10(5-7-13(12)18)22-17(24)11-6-4-9(2)14(19)15(11)20/h4-8H,3H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XVHGEBRWOBWHHV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |