C19H16ClN5O2 — CID 131937130
N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2-pyridin-2-ylpyrimidine-5-carboxamide (PubChem CID 131937130) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2-pyridin-2-ylpyrimidine-5-carboxamide.
| Compound Name | N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2-pyridin-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 131937130 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[4-chloro-3-(ethylcarbamoyl)phenyl]-2-pyridin-2-ylpyrimidine-5-carboxamide |
| SMILES | CCNC(=O)c1cc(NC(=O)c2cnc(-c3ccccn3)nc2)ccc1Cl |
| InChI | InChI=1S/C19H16ClN5O2/c1-2-21-19(27)14-9-13(6-7-15(14)20)25-18(26)12-10-23-17(24-11-12)16-5-3-4-8-22-16/h3-11H,2H2,1H3,(H,21,27)(H,25,26) |
| InChIKey | ZEHPYTYKKJURCM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |