C13H18BClN2O3 — CID 164653314
[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (PubChem CID 164653314) has the molecular formula C13H18BClN2O3 and a molecular weight of 296.56 g/mol. Its IUPAC name is [4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea.
| Compound Name | [4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 164653314 |
| Molecular Formula | C13H18BClN2O3 |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| SMILES | CC1(C)OB(c2cc(NC(N)=O)ccc2Cl)OC1(C)C |
| InChI | InChI=1S/C13H18BClN2O3/c1-12(2)13(3,4)20-14(19-12)9-7-8(17-11(16)18)5-6-10(9)15/h5-7H,1-4H3,(H3,16,17,18) |
| InChIKey | BKHAIOZQIQKBMD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|