C20H23BClNO5S — CID 66895871
N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylsulfonylbenzamide (PubChem CID 66895871) has the molecular formula C20H23BClNO5S and a molecular weight of 435.74 g/mol. Its IUPAC name is N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 66895871 |
| Molecular Formula | C20H23BClNO5S |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylsulfonylbenzamide |
| SMILES | CC1(C)OB(c2cc(NC(=O)c3ccc(S(C)(=O)=O)cc3)ccc2Cl)OC1(C)C |
| InChI | InChI=1S/C20H23BClNO5S/c1-19(2)20(3,4)28-21(27-19)16-12-14(8-11-17(16)22)23-18(24)13-6-9-15(10-7-13)29(5,25)26/h6-12H,1-5H3,(H,23,24) |
| InChIKey | RBKKQAHPCJTIOJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|