C18H29BN2O5S — CID 142516741
N-[3-(tert-butylsulfamoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 142516741) has the molecular formula C18H29BN2O5S and a molecular weight of 396.32 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 142516741 |
| Molecular Formula | C18H29BN2O5S |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H29BN2O5S/c1-12(22)20-13-9-10-14(19-25-17(5,6)18(7,8)26-19)15(11-13)27(23,24)21-16(2,3)4/h9-11,21H,1-8H3,(H,20,22) |
| InChIKey | VMUXGBVXHRSSRA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|