C17H28BNO4S — CID 75486808
N-tert-butyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 75486808) has the molecular formula C17H28BNO4S and a molecular weight of 353.29 g/mol. Its IUPAC name is N-tert-butyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-tert-butyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75486808 |
| Molecular Formula | C17H28BNO4S |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-tert-butyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C17H28BNO4S/c1-12-9-13(18-22-16(5,6)17(7,8)23-18)11-14(10-12)24(20,21)19-15(2,3)4/h9-11,19H,1-8H3 |
| InChIKey | JNUYJBWIVXTLAP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|