C18H24BNO5S — CID 75486806
N-(furan-2-ylmethyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 75486806) has the molecular formula C18H24BNO5S and a molecular weight of 377.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75486806 |
| Molecular Formula | C18H24BNO5S |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H24BNO5S/c1-13-9-14(19-24-17(2,3)18(4,5)25-19)11-16(10-13)26(21,22)20-12-15-7-6-8-23-15/h6-11,20H,12H2,1-5H3 |
| InChIKey | PBVHSMBFEOUFMM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|