C17H24BF2NO4S — CID 165368782
N-(3,3-difluorocyclobutyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 165368782) has the molecular formula C17H24BF2NO4S and a molecular weight of 387.26 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-(3,3-difluorocyclobutyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 165368782 |
| Molecular Formula | C17H24BF2NO4S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(=O)(=O)NC2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C17H24BF2NO4S/c1-11-6-12(18-24-15(2,3)16(4,5)25-18)8-14(7-11)26(22,23)21-13-9-17(19,20)10-13/h6-8,13,21H,9-10H2,1-5H3 |
| InChIKey | FLQDHGYEIWPPNL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|