C15H23NO2S — CID 114545447
N-(3,3-dimethylcyclopentyl)-3,5-dimethylbenzenesulfonamide (PubChem CID 114545447) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-3,5-dimethylbenzenesulfonamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 114545447 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)NC2CCC(C)(C)C2)c1 |
| InChI | InChI=1S/C15H23NO2S/c1-11-7-12(2)9-14(8-11)19(17,18)16-13-5-6-15(3,4)10-13/h7-9,13,16H,5-6,10H2,1-4H3 |
| InChIKey | OSRPQPGVJQWOTB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |