C15H22N2O2S — CID 107422453
N-(3,3-dimethylcyclopentyl)-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107422453) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107422453 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | CC1(C)CCC(NS(=O)(=O)c2ccc3c(c2)CNC3)C1 |
| InChI | InChI=1S/C15H22N2O2S/c1-15(2)6-5-13(8-15)17-20(18,19)14-4-3-11-9-16-10-12(11)7-14/h3-4,7,13,16-17H,5-6,8-10H2,1-2H3 |
| InChIKey | FCXUIUBZBIUGBG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |