C14H18N2O2S — CID 107422243
N-cyclohex-3-en-1-yl-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107422243) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-cyclohex-3-en-1-yl-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107422243 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-cyclohex-3-en-1-yl-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | O=S(=O)(NC1CC=CCC1)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C14H18N2O2S/c17-19(18,16-13-4-2-1-3-5-13)14-7-6-11-9-15-10-12(11)8-14/h1-2,6-8,13,15-16H,3-5,9-10H2 |
| InChIKey | LXXWAEPHZILHAH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|