C13H18N2O2S2 — CID 107422407
N-(thian-3-yl)-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107422407) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-(thian-3-yl)-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-(thian-3-yl)-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107422407 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(thian-3-yl)-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCCSC1)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C13H18N2O2S2/c16-19(17,15-12-2-1-5-18-9-12)13-4-3-10-7-14-8-11(10)6-13/h3-4,6,12,14-15H,1-2,5,7-9H2 |
| InChIKey | KLRMPJJEFHOZOS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |