C11H12N2O3S — CID 129205364
N-cyclopropyl-1-oxo-2,3-dihydroisoindole-5-sulfonamide (PubChem CID 129205364) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is N-cyclopropyl-1-oxo-2,3-dihydroisoindole-5-sulfonamide.
| Compound Name | N-cyclopropyl-1-oxo-2,3-dihydroisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 129205364 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N-cyclopropyl-1-oxo-2,3-dihydroisoindole-5-sulfonamide |
| SMILES | O=C1NCc2cc(S(=O)(=O)NC3CC3)ccc21 |
| InChI | InChI=1S/C11H12N2O3S/c14-11-10-4-3-9(5-7(10)6-12-11)17(15,16)13-8-1-2-8/h3-5,8,13H,1-2,6H2,(H,12,14) |
| InChIKey | RHVNJLKDZJJYAT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |