C13H16N2O4S — CID 126783536
1-oxo-N-(oxolan-3-yl)-3,4-dihydro-2H-isoquinoline-7-sulfonamide (PubChem CID 126783536) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 1-oxo-N-(oxolan-3-yl)-3,4-dihydro-2H-isoquinoline-7-sulfonamide.
| Compound Name | 1-oxo-N-(oxolan-3-yl)-3,4-dihydro-2H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 126783536 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-oxo-N-(oxolan-3-yl)-3,4-dihydro-2H-isoquinoline-7-sulfonamide |
| SMILES | O=C1NCCc2ccc(S(=O)(=O)NC3CCOC3)cc21 |
| InChI | InChI=1S/C13H16N2O4S/c16-13-12-7-11(2-1-9(12)3-5-14-13)20(17,18)15-10-4-6-19-8-10/h1-2,7,10,15H,3-6,8H2,(H,14,16) |
| InChIKey | KJBVXBFMALAVCH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |