C11H12N2O5S — CID 110868860
2-oxo-N-(oxolan-3-yl)-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 110868860) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-oxo-N-(oxolan-3-yl)-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-oxo-N-(oxolan-3-yl)-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110868860 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-oxo-N-(oxolan-3-yl)-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NC3CCOC3)cc2o1 |
| InChI | InChI=1S/C11H12N2O5S/c14-11-12-9-2-1-8(5-10(9)18-11)19(15,16)13-7-3-4-17-6-7/h1-2,5,7,13H,3-4,6H2,(H,12,14) |
| InChIKey | SYPFULANRHYVPG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |