C18H28ClN3O3S — CID 119987279
N-[2-(cycloheptylamino)ethyl]-1-oxo-3,4-dihydro-2H-isoquinoline-7-sulfonamide;hydrochloride (PubChem CID 119987279) has the molecular formula C18H28ClN3O3S and a molecular weight of 401.96 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1-oxo-3,4-dihydro-2H-isoquinoline-7-sulfonamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1-oxo-3,4-dihydro-2H-isoquinoline-7-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119987279 |
| Molecular Formula | C18H28ClN3O3S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1-oxo-3,4-dihydro-2H-isoquinoline-7-sulfonamide;hydrochloride |
| SMILES | Cl.O=C1NCCc2ccc(S(=O)(=O)NCCNC3CCCCCC3)cc21 |
| InChI | InChI=1S/C18H27N3O3S.ClH/c22-18-17-13-16(8-7-14(17)9-10-20-18)25(23,24)21-12-11-19-15-5-3-1-2-4-6-15;/h7-8,13,15,19,21H,1-6,9-12H2,(H,20,22);1H |
| InChIKey | FGSLUCPZAUZRMI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|