C17H27ClN2O3S — CID 119987288
N-[2-(cycloheptylamino)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide;hydrochloride (PubChem CID 119987288) has the molecular formula C17H27ClN2O3S and a molecular weight of 374.93 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119987288 |
| Molecular Formula | C17H27ClN2O3S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCCNC1CCCCCC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H26N2O3S.ClH/c20-23(21,16-7-8-17-14(13-16)9-12-22-17)19-11-10-18-15-5-3-1-2-4-6-15;/h7-8,13,15,18-19H,1-6,9-12H2;1H |
| InChIKey | STFMIMZHCVJFTA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|