C16H18N2O3S — CID 120715684
N-[2-(4-aminophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 120715684) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 120715684 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | Nc1ccc(CCNS(=O)(=O)c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C16H18N2O3S/c17-14-3-1-12(2-4-14)7-9-18-22(19,20)15-5-6-16-13(11-15)8-10-21-16/h1-6,11,18H,7-10,17H2 |
| InChIKey | QGPAMEVSIOGSFC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|