C20H32ClN3O3S — CID 119987148
1-acetyl-N-[2-(cycloheptylamino)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride (PubChem CID 119987148) has the molecular formula C20H32ClN3O3S and a molecular weight of 430.01 g/mol. Its IUPAC name is 1-acetyl-N-[2-(cycloheptylamino)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride.
| Compound Name | 1-acetyl-N-[2-(cycloheptylamino)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119987148 |
| Molecular Formula | C20H32ClN3O3S |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-acetyl-N-[2-(cycloheptylamino)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride |
| SMILES | CC(=O)N1CCCc2ccc(S(=O)(=O)NCCNC3CCCCCC3)cc21.Cl |
| InChI | InChI=1S/C20H31N3O3S.ClH/c1-16(24)23-14-6-7-17-10-11-19(15-20(17)23)27(25,26)22-13-12-21-18-8-4-2-3-5-9-18;/h10-11,15,18,21-22H,2-9,12-14H2,1H3;1H |
| InChIKey | OXURNDPUFZOIRP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|