C19H24ClN3O3S — CID 120715780
1-acetyl-N-[2-(4-aminophenyl)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride (PubChem CID 120715780) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is 1-acetyl-N-[2-(4-aminophenyl)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride.
| Compound Name | 1-acetyl-N-[2-(4-aminophenyl)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715780 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-acetyl-N-[2-(4-aminophenyl)ethyl]-3,4-dihydro-2H-quinoline-7-sulfonamide;hydrochloride |
| SMILES | CC(=O)N1CCCc2ccc(S(=O)(=O)NCCc3ccc(N)cc3)cc21.Cl |
| InChI | InChI=1S/C19H23N3O3S.ClH/c1-14(23)22-12-2-3-16-6-9-18(13-19(16)22)26(24,25)21-11-10-15-4-7-17(20)8-5-15;/h4-9,13,21H,2-3,10-12,20H2,1H3;1H |
| InChIKey | FQNKIHKJZIPKRO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|