C16H26N2O4S2 — CID 119987331
N-[2-(cycloheptylamino)ethyl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 119987331) has the molecular formula C16H26N2O4S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 119987331 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NCCNC2CCCCCC2)c1 |
| InChI | InChI=1S/C16H26N2O4S2/c1-23(19,20)15-9-6-10-16(13-15)24(21,22)18-12-11-17-14-7-4-2-3-5-8-14/h6,9-10,13-14,17-18H,2-5,7-8,11-12H2,1H3 |
| InChIKey | ZXGICTGKBKFHCY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|