C24H37N3O2S — CID 139937805
N-[4-[2-(cyclooctylamino)ethylamino]butyl]naphthalene-2-sulfonamide (PubChem CID 139937805) has the molecular formula C24H37N3O2S and a molecular weight of 431.65 g/mol. Its IUPAC name is N-[4-[2-(cyclooctylamino)ethylamino]butyl]naphthalene-2-sulfonamide.
| Compound Name | N-[4-[2-(cyclooctylamino)ethylamino]butyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 139937805 |
| Molecular Formula | C24H37N3O2S |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-[4-[2-(cyclooctylamino)ethylamino]butyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCCNCCNC1CCCCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H37N3O2S/c28-30(29,24-15-14-21-10-6-7-11-22(21)20-24)27-17-9-8-16-25-18-19-26-23-12-4-2-1-3-5-13-23/h6-7,10-11,14-15,20,23,25-27H,1-5,8-9,12-13,16-19H2 |
| InChIKey | PSTFQQFSDBFKFE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|